C16H10F6N4O6 — CID 55794086
2-nitro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-5-(2,2,2-trifluoroethoxy)benzohydrazide (PubChem CID 55794086) has the molecular formula C16H10F6N4O6 and a molecular weight of 468.27 g/mol. Its IUPAC name is 2-nitro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-5-(2,2,2-trifluoroethoxy)benzohydrazide.
| Compound Name | 2-nitro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-5-(2,2,2-trifluoroethoxy)benzohydrazide |
|---|---|
| PubChem CID | 55794086 |
| Molecular Formula | C16H10F6N4O6 |
| Molecular Weight | 468.27 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 2-nitro-N'-[2-nitro-4-(trifluoromethyl)phenyl]-5-(2,2,2-trifluoroethoxy)benzohydrazide |
| SMILES | O=C(NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1cc(OCC(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10F6N4O6/c17-15(18,19)7-32-9-2-4-12(25(28)29)10(6-9)14(27)24-23-11-3-1-8(16(20,21)22)5-13(11)26(30)31/h1-6,23H,7H2,(H,24,27) |
| InChIKey | YSHSUBRLXMFJKB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|