C15H11F4N3O3 — CID 29410018
5-fluoro-2-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide (PubChem CID 29410018) has the molecular formula C15H11F4N3O3 and a molecular weight of 357.26 g/mol. Its IUPAC name is 5-fluoro-2-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide.
| Compound Name | 5-fluoro-2-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide |
|---|---|
| PubChem CID | 29410018 |
| Molecular Formula | C15H11F4N3O3 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 5-fluoro-2-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide |
| SMILES | Cc1ccc(F)cc1C(=O)NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11F4N3O3/c1-8-2-4-10(16)7-11(8)14(23)21-20-12-5-3-9(15(17,18)19)6-13(12)22(24)25/h2-7,20H,1H3,(H,21,23) |
| InChIKey | QANYYNPFGFDYJO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|