C16H15F3N4O2S — CID 7941413
1-(3,4-dimethylphenyl)-3-[2-nitro-4-(trifluoromethyl)anilino]thiourea (PubChem CID 7941413) has the molecular formula C16H15F3N4O2S and a molecular weight of 384.38 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[2-nitro-4-(trifluoromethyl)anilino]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[2-nitro-4-(trifluoromethyl)anilino]thiourea |
|---|---|
| PubChem CID | 7941413 |
| Molecular Formula | C16H15F3N4O2S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[2-nitro-4-(trifluoromethyl)anilino]thiourea |
| SMILES | Cc1ccc(NC(=S)NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C16H15F3N4O2S/c1-9-3-5-12(7-10(9)2)20-15(26)22-21-13-6-4-11(16(17,18)19)8-14(13)23(24)25/h3-8,21H,1-2H3,(H2,20,22,26) |
| InChIKey | KJDZCWQMKZLLGL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|