C13H10F3N3O3S — CID 29409132
3-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]thiophene-2-carbohydrazide (PubChem CID 29409132) has the molecular formula C13H10F3N3O3S and a molecular weight of 345.30 g/mol. Its IUPAC name is 3-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]thiophene-2-carbohydrazide.
| Compound Name | 3-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 29409132 |
| Molecular Formula | C13H10F3N3O3S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-methyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]thiophene-2-carbohydrazide |
| SMILES | Cc1ccsc1C(=O)NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10F3N3O3S/c1-7-4-5-23-11(7)12(20)18-17-9-3-2-8(13(14,15)16)6-10(9)19(21)22/h2-6,17H,1H3,(H,18,20) |
| InChIKey | NJSAJUALIYCIRJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|