C16H10F3N3O3S — CID 29409626
N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 29409626) has the molecular formula C16H10F3N3O3S and a molecular weight of 381.34 g/mol. Its IUPAC name is N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 29409626 |
| Molecular Formula | C16H10F3N3O3S |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N'-[2-nitro-4-(trifluoromethyl)phenyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | O=C(NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1cc2ccccc2s1 |
| InChI | InChI=1S/C16H10F3N3O3S/c17-16(18,19)10-5-6-11(12(8-10)22(24)25)20-21-15(23)14-7-9-3-1-2-4-13(9)26-14/h1-8,20H,(H,21,23) |
| InChIKey | WJTYKGPPFBOJGS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|