C14H9F3N4O5 — CID 29409066
2-nitro-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide (PubChem CID 29409066) has the molecular formula C14H9F3N4O5 and a molecular weight of 370.24 g/mol. Its IUPAC name is 2-nitro-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide.
| Compound Name | 2-nitro-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide |
|---|---|
| PubChem CID | 29409066 |
| Molecular Formula | C14H9F3N4O5 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2-nitro-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide |
| SMILES | O=C(NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9F3N4O5/c15-14(16,17)8-5-6-10(12(7-8)21(25)26)18-19-13(22)9-3-1-2-4-11(9)20(23)24/h1-7,18H,(H,19,22) |
| InChIKey | MHVPUBSAOKZKNS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|