C16H14F3N3O5 — CID 29409295
3,4-dimethoxy-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide (PubChem CID 29409295) has the molecular formula C16H14F3N3O5 and a molecular weight of 385.30 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide.
| Compound Name | 3,4-dimethoxy-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide |
|---|---|
| PubChem CID | 29409295 |
| Molecular Formula | C16H14F3N3O5 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 3,4-dimethoxy-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H14F3N3O5/c1-26-13-6-3-9(7-14(13)27-2)15(23)21-20-11-5-4-10(16(17,18)19)8-12(11)22(24)25/h3-8,20H,1-2H3,(H,21,23) |
| InChIKey | YHIUWZRLIHXYCM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|