C20H15F3N4O5 — CID 29409356
N-[2-methyl-5-[[2-nitro-4-(trifluoromethyl)anilino]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 29409356) has the molecular formula C20H15F3N4O5 and a molecular weight of 448.36 g/mol. Its IUPAC name is N-[2-methyl-5-[[2-nitro-4-(trifluoromethyl)anilino]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-methyl-5-[[2-nitro-4-(trifluoromethyl)anilino]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 29409356 |
| Molecular Formula | C20H15F3N4O5 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[2-methyl-5-[[2-nitro-4-(trifluoromethyl)anilino]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C20H15F3N4O5/c1-11-4-5-12(9-15(11)24-19(29)17-3-2-8-32-17)18(28)26-25-14-7-6-13(20(21,22)23)10-16(14)27(30)31/h2-10,25H,1H3,(H,24,29)(H,26,28) |
| InChIKey | ICGAEBPNJVMQTO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|