C21H14F3N5O3 — CID 29409619
4-(benzimidazol-1-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide (PubChem CID 29409619) has the molecular formula C21H14F3N5O3 and a molecular weight of 441.37 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide.
| Compound Name | 4-(benzimidazol-1-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide |
|---|---|
| PubChem CID | 29409619 |
| Molecular Formula | C21H14F3N5O3 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 4-(benzimidazol-1-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]benzohydrazide |
| SMILES | O=C(NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc(-n2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C21H14F3N5O3/c22-21(23,24)14-7-10-17(19(11-14)29(31)32)26-27-20(30)13-5-8-15(9-6-13)28-12-25-16-3-1-2-4-18(16)28/h1-12,26H,(H,27,30) |
| InChIKey | DOKOZILTXVCHFI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|