C17H12F3N5O5S2 — CID 55523358
N'-[2-nitro-4-(trifluoromethyl)phenyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbohydrazide (PubChem CID 55523358) has the molecular formula C17H12F3N5O5S2 and a molecular weight of 487.44 g/mol. Its IUPAC name is N'-[2-nitro-4-(trifluoromethyl)phenyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbohydrazide.
| Compound Name | N'-[2-nitro-4-(trifluoromethyl)phenyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbohydrazide |
|---|---|
| PubChem CID | 55523358 |
| Molecular Formula | C17H12F3N5O5S2 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | N'-[2-nitro-4-(trifluoromethyl)phenyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbohydrazide |
| SMILES | O=C(NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C17H12F3N5O5S2/c18-17(19,20)10-2-3-11(13(8-10)25(27)28)21-22-15(26)9-1-4-12-14(7-9)31-16-23-32(29,30)6-5-24(12)16/h1-4,7-8,21H,5-6H2,(H,22,26) |
| InChIKey | PQKFVKOIUVQHIN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|