C20H20N2O4S2 — CID 7603720
(4-propan-2-ylphenyl)methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 7603720) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is (4-propan-2-ylphenyl)methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | (4-propan-2-ylphenyl)methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 7603720 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | (4-propan-2-ylphenyl)methyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | CC(C)c1ccc(COC(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)cc1 |
| InChI | InChI=1S/C20H20N2O4S2/c1-13(2)15-5-3-14(4-6-15)12-26-19(23)16-7-8-17-18(11-16)27-20-21-28(24,25)10-9-22(17)20/h3-8,11,13H,9-10,12H2,1-2H3 |
| InChIKey | CWCQQABCKDANBC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |