C20H17N3O7S2 — CID 55309630
[2-(2-methoxycarbonylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 55309630) has the molecular formula C20H17N3O7S2 and a molecular weight of 475.50 g/mol. Its IUPAC name is [2-(2-methoxycarbonylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 55309630 |
| Molecular Formula | C20H17N3O7S2 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C20H17N3O7S2/c1-29-19(26)13-4-2-3-5-14(13)21-17(24)11-30-18(25)12-6-7-15-16(10-12)31-20-22-32(27,28)9-8-23(15)20/h2-7,10H,8-9,11H2,1H3,(H,21,24) |
| InChIKey | SVHIWUVUECXWCW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |