C16H13N3O3S2 — CID 8713711
2,2-dioxo-N-phenyl-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 8713711) has the molecular formula C16H13N3O3S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2,2-dioxo-N-phenyl-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | 2,2-dioxo-N-phenyl-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 8713711 |
| Molecular Formula | C16H13N3O3S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 2,2-dioxo-N-phenyl-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C16H13N3O3S2/c20-15(17-12-4-2-1-3-5-12)11-6-7-13-14(10-11)23-16-18-24(21,22)9-8-19(13)16/h1-7,10H,8-9H2,(H,17,20) |
| InChIKey | TZXDLXLTEVIXOK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |