C22H17N3O3S2 — CID 55329314
2,2-dioxo-N-(2-phenylphenyl)-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 55329314) has the molecular formula C22H17N3O3S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2,2-dioxo-N-(2-phenylphenyl)-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | 2,2-dioxo-N-(2-phenylphenyl)-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 55329314 |
| Molecular Formula | C22H17N3O3S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 2,2-dioxo-N-(2-phenylphenyl)-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C22H17N3O3S2/c26-21(23-18-9-5-4-8-17(18)15-6-2-1-3-7-15)16-10-11-19-20(14-16)29-22-24-30(27,28)13-12-25(19)22/h1-11,14H,12-13H2,(H,23,26) |
| InChIKey | NHZRRZABAXYQKB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |