C21H15N5O3S3 — CID 55341227
N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 55341227) has the molecular formula C21H15N5O3S3 and a molecular weight of 481.58 g/mol. Its IUPAC name is N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 55341227 |
| Molecular Formula | C21H15N5O3S3 |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | O=C(Nc1nc(-c2c[nH]c3ccccc23)cs1)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C21H15N5O3S3/c27-19(12-5-6-17-18(9-12)31-21-25-32(28,29)8-7-26(17)21)24-20-23-16(11-30-20)14-10-22-15-4-2-1-3-13(14)15/h1-6,9-11,22H,7-8H2,(H,23,24,27) |
| InChIKey | GHVLZLIIGQNBFD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |