C20H14F2N4O3S3 — CID 2541524
N-[4-(3,4-difluorophenyl)-5-methyl-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 2541524) has the molecular formula C20H14F2N4O3S3 and a molecular weight of 492.55 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-5-methyl-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-5-methyl-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 2541524 |
| Molecular Formula | C20H14F2N4O3S3 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-5-methyl-1,3-thiazol-2-yl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | Cc1sc(NC(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)nc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H14F2N4O3S3/c1-10-17(11-2-4-13(21)14(22)8-11)23-19(30-10)24-18(27)12-3-5-15-16(9-12)31-20-25-32(28,29)7-6-26(15)20/h2-5,8-9H,6-7H2,1H3,(H,23,24,27) |
| InChIKey | WRUBOBBUMKRLLU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |