C16H12FN3O3S2 — CID 8744530
N-(4-fluorophenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 8744530) has the molecular formula C16H12FN3O3S2 and a molecular weight of 377.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 8744530 |
| Molecular Formula | C16H12FN3O3S2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | N-(4-fluorophenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C16H12FN3O3S2/c17-11-2-4-12(5-3-11)18-15(21)10-1-6-13-14(9-10)24-16-19-25(22,23)8-7-20(13)16/h1-6,9H,7-8H2,(H,18,21) |
| InChIKey | JDAWPLHIZDRVOU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |