C23H18N4O4S2 — CID 55796684
N-(3-benzamidophenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 55796684) has the molecular formula C23H18N4O4S2 and a molecular weight of 478.56 g/mol. Its IUPAC name is N-(3-benzamidophenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-(3-benzamidophenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 55796684 |
| Molecular Formula | C23H18N4O4S2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | N-(3-benzamidophenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)c1)c1ccccc1 |
| InChI | InChI=1S/C23H18N4O4S2/c28-21(15-5-2-1-3-6-15)24-17-7-4-8-18(14-17)25-22(29)16-9-10-19-20(13-16)32-23-26-33(30,31)12-11-27(19)23/h1-10,13-14H,11-12H2,(H,24,28)(H,25,29) |
| InChIKey | FVNONPDSWNOKOV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |