C23H19N3O4S2 — CID 55342966
N-[2-(4-methylphenoxy)phenyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 55342966) has the molecular formula C23H19N3O4S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is N-[2-(4-methylphenoxy)phenyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-[2-(4-methylphenoxy)phenyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 55342966 |
| Molecular Formula | C23H19N3O4S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | N-[2-(4-methylphenoxy)phenyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | Cc1ccc(Oc2ccccc2NC(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)cc1 |
| InChI | InChI=1S/C23H19N3O4S2/c1-15-6-9-17(10-7-15)30-20-5-3-2-4-18(20)24-22(27)16-8-11-19-21(14-16)31-23-25-32(28,29)13-12-26(19)23/h2-11,14H,12-13H2,1H3,(H,24,27) |
| InChIKey | MXZCPHJRXXNFEY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |