C21H21N3O5S2 — CID 55455320
methyl 3-[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)amino]-3-(4-methylphenyl)propanoate (PubChem CID 55455320) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is methyl 3-[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)amino]-3-(4-methylphenyl)propanoate.
| Compound Name | methyl 3-[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)amino]-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 55455320 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | methyl 3-[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)amino]-3-(4-methylphenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H21N3O5S2/c1-13-3-5-14(6-4-13)16(12-19(25)29-2)22-20(26)15-7-8-17-18(11-15)30-21-23-31(27,28)10-9-24(17)21/h3-8,11,16H,9-10,12H2,1-2H3,(H,22,26) |
| InChIKey | IYQHOMFHXCNXMG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |