C21H18FN5O3S2 — CID 55453827
N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 55453827) has the molecular formula C21H18FN5O3S2 and a molecular weight of 471.54 g/mol. Its IUPAC name is N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 55453827 |
| Molecular Formula | C21H18FN5O3S2 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | Cn1ccnc1C(NC(=O)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12)c1cccc(F)c1 |
| InChI | InChI=1S/C21H18FN5O3S2/c1-26-8-7-23-19(26)18(13-3-2-4-15(22)11-13)24-20(28)14-5-6-16-17(12-14)31-21-25-32(29,30)10-9-27(16)21/h2-8,11-12,18H,9-10H2,1H3,(H,24,28) |
| InChIKey | CJOVZKGYRWFILS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |