C19H18FN5O3S — CID 25325058
N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 25325058) has the molecular formula C19H18FN5O3S and a molecular weight of 415.45 g/mol. Its IUPAC name is N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 25325058 |
| Molecular Formula | C19H18FN5O3S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | Cn1ccnc1[C@@H](NC(=O)C1=CN2CCS(=O)(=O)N=C2C=C1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H18FN5O3S/c1-24-8-7-21-18(24)17(13-3-2-4-15(20)11-13)22-19(26)14-5-6-16-23-29(27,28)10-9-25(16)12-14/h2-8,11-12,17H,9-10H2,1H3,(H,22,26)/t17-/m0/s1 |
| InChIKey | GZTMPAISGGOWDO-KRWDZBQOSA-N |
| XLogP | 1.26 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |