C17H16FN3O2 — CID 25368073
N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2-methylfuran-3-carboxamide (PubChem CID 25368073) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 25368073 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N[C@H](c1cccc(F)c1)c1nccn1C |
| InChI | InChI=1S/C17H16FN3O2/c1-11-14(6-9-23-11)17(22)20-15(16-19-7-8-21(16)2)12-4-3-5-13(18)10-12/h3-10,15H,1-2H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | YTELOOMZTCMHAD-OAHLLOKOSA-N |
| XLogP | 2.98 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |