C16H16FN5O — CID 31503143
N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-1-methylpyrazole-4-carboxamide (PubChem CID 31503143) has the molecular formula C16H16FN5O and a molecular weight of 313.34 g/mol. Its IUPAC name is N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31503143 |
| Molecular Formula | C16H16FN5O |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)N[C@H](c2cccc(F)c2)c2nccn2C)cn1 |
| InChI | InChI=1S/C16H16FN5O/c1-21-7-6-18-15(21)14(11-4-3-5-13(17)8-11)20-16(23)12-9-19-22(2)10-12/h3-10,14H,1-2H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | XZFSKENNDDGCMQ-CQSZACIVSA-N |
| XLogP | 1.81 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |