C22H20FN5O — CID 46698449
N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 46698449) has the molecular formula C22H20FN5O and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46698449 |
| Molecular Formula | C22H20FN5O |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | Cn1ccnc1C(NC(=O)c1ccc(Cn2cccn2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H20FN5O/c1-27-13-11-24-21(27)20(18-4-2-5-19(23)14-18)26-22(29)17-8-6-16(7-9-17)15-28-12-3-10-25-28/h2-14,20H,15H2,1H3,(H,26,29) |
| InChIKey | DPULMNWVUNGRRY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |