C20H20FN3O3S — CID 31502802
N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(methylsulfonylmethyl)benzamide (PubChem CID 31502802) has the molecular formula C20H20FN3O3S and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 31502802 |
| Molecular Formula | C20H20FN3O3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(methylsulfonylmethyl)benzamide |
| SMILES | Cn1ccnc1[C@@H](NC(=O)c1cccc(CS(C)(=O)=O)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H20FN3O3S/c1-24-10-9-22-19(24)18(15-6-4-8-17(21)12-15)23-20(25)16-7-3-5-14(11-16)13-28(2,26)27/h3-12,18H,13H2,1-2H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | WHJWOLFAZNFFOD-SFHVURJKSA-N |
| XLogP | 2.62 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |