C20H21FN4O3S — CID 37281759
3-(ethylsulfamoyl)-N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzamide (PubChem CID 37281759) has the molecular formula C20H21FN4O3S and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-(ethylsulfamoyl)-N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzamide.
| Compound Name | 3-(ethylsulfamoyl)-N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 37281759 |
| Molecular Formula | C20H21FN4O3S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-(ethylsulfamoyl)-N-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)N[C@@H](c2cccc(F)c2)c2nccn2C)c1 |
| InChI | InChI=1S/C20H21FN4O3S/c1-3-23-29(27,28)17-9-5-7-15(13-17)20(26)24-18(19-22-10-11-25(19)2)14-6-4-8-16(21)12-14/h4-13,18,23H,3H2,1-2H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | OUPAYFAHMXPHFX-SFHVURJKSA-N |
| XLogP | 2.38 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |