C26H26N4O3S — CID 55461455
3-[ethyl(phenyl)sulfamoyl]-N-[(1-methylimidazol-2-yl)-phenylmethyl]benzamide (PubChem CID 55461455) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is 3-[ethyl(phenyl)sulfamoyl]-N-[(1-methylimidazol-2-yl)-phenylmethyl]benzamide.
| Compound Name | 3-[ethyl(phenyl)sulfamoyl]-N-[(1-methylimidazol-2-yl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 55461455 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-[ethyl(phenyl)sulfamoyl]-N-[(1-methylimidazol-2-yl)-phenylmethyl]benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)NC(c2ccccc2)c2nccn2C)c1 |
| InChI | InChI=1S/C26H26N4O3S/c1-3-30(22-14-8-5-9-15-22)34(32,33)23-16-10-13-21(19-23)26(31)28-24(20-11-6-4-7-12-20)25-27-17-18-29(25)2/h4-19,24H,3H2,1-2H3,(H,28,31) |
| InChIKey | PTYVAHSITAATRZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |