C21H22FN5O2 — CID 46513046
N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-6-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 46513046) has the molecular formula C21H22FN5O2 and a molecular weight of 395.44 g/mol. Its IUPAC name is N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-6-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-6-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46513046 |
| Molecular Formula | C21H22FN5O2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-6-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | Cn1ccnc1C(NC(=O)c1ccc(N2CCOCC2)nc1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H22FN5O2/c1-26-8-7-23-20(26)19(15-3-2-4-17(22)13-15)25-21(28)16-5-6-18(24-14-16)27-9-11-29-12-10-27/h2-8,13-14,19H,9-12H2,1H3,(H,25,28) |
| InChIKey | FJDWGBOOXSPVQJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |