C18H15N3O6S2 — CID 56576421
methyl 3-[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)amino]-2-hydroxybenzoate (PubChem CID 56576421) has the molecular formula C18H15N3O6S2 and a molecular weight of 433.47 g/mol. Its IUPAC name is methyl 3-[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 56576421 |
| Molecular Formula | C18H15N3O6S2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | methyl 3-[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)c1O |
| InChI | InChI=1S/C18H15N3O6S2/c1-27-17(24)11-3-2-4-12(15(11)22)19-16(23)10-5-6-13-14(9-10)28-18-20-29(25,26)8-7-21(13)18/h2-6,9,22H,7-8H2,1H3,(H,19,23) |
| InChIKey | RVFZTFODIHISDY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|