C17H14ClN3O3S2 — CID 2541463
N-(5-chloro-2-methylphenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 2541463) has the molecular formula C17H14ClN3O3S2 and a molecular weight of 407.90 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 2541463 |
| Molecular Formula | C17H14ClN3O3S2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C17H14ClN3O3S2/c1-10-2-4-12(18)9-13(10)19-16(22)11-3-5-14-15(8-11)25-17-20-26(23,24)7-6-21(14)17/h2-5,8-9H,6-7H2,1H3,(H,19,22) |
| InChIKey | LNSURMGYJPHPHD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |