C18H19N3OS — CID 2566619
N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]cyclohexanecarboxamide (PubChem CID 2566619) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 2566619 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1nc(-c2c[nH]c3ccccc23)cs1)C1CCCCC1 |
| InChI | InChI=1S/C18H19N3OS/c22-17(12-6-2-1-3-7-12)21-18-20-16(11-23-18)14-10-19-15-9-5-4-8-13(14)15/h4-5,8-12,19H,1-3,6-7H2,(H,20,21,22) |
| InChIKey | NETDTPJRPZHMAP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |