C20H14N4O2S — CID 8839559
2-(4-cyanophenoxy)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 8839559) has the molecular formula C20H14N4O2S and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 8839559 |
| Molecular Formula | C20H14N4O2S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | N#Cc1ccc(OCC(=O)Nc2nc(-c3c[nH]c4ccccc34)cs2)cc1 |
| InChI | InChI=1S/C20H14N4O2S/c21-9-13-5-7-14(8-6-13)26-11-19(25)24-20-23-18(12-27-20)16-10-22-17-4-2-1-3-15(16)17/h1-8,10,12,22H,11H2,(H,23,24,25) |
| InChIKey | MLTRRBQDSIYGBA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |