C17H12N4O2S — CID 4799321
2-(4-cyanophenoxy)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 4799321) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4799321 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | N#Cc1ccc(OCC(=O)Nc2nc(-c3cccnc3)cs2)cc1 |
| InChI | InChI=1S/C17H12N4O2S/c18-8-12-3-5-14(6-4-12)23-10-16(22)21-17-20-15(11-24-17)13-2-1-7-19-9-13/h1-7,9,11H,10H2,(H,20,21,22) |
| InChIKey | BBQTZYTXTRDHKV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |