C13H8N4OS — CID 146190059
2-cyano-N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 146190059) has the molecular formula C13H8N4OS and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-cyano-N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-cyano-N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 146190059 |
| Molecular Formula | C13H8N4OS |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-cyano-N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | N#CCC(=O)Nc1nc(-c2ccc(C#N)cc2)cs1 |
| InChI | InChI=1S/C13H8N4OS/c14-6-5-12(18)17-13-16-11(8-19-13)10-3-1-9(7-15)2-4-10/h1-4,8H,5H2,(H,16,17,18) |
| InChIKey | DUKCWLGLVURQIH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |