C21H21N3OS — CID 4577236
N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide (PubChem CID 4577236) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4577236 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide |
| SMILES | N#Cc1ccc(-c2csc(NC(=O)C34CC5CC(CC(C5)C3)C4)n2)cc1 |
| InChI | InChI=1S/C21H21N3OS/c22-11-13-1-3-17(4-2-13)18-12-26-20(23-18)24-19(25)21-8-14-5-15(9-21)7-16(6-14)10-21/h1-4,12,14-16H,5-10H2,(H,23,24,25) |
| InChIKey | JCWHQTGBWSRKHK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |