C20H20F2N2OS — CID 5065233
N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide (PubChem CID 5065233) has the molecular formula C20H20F2N2OS and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 5065233 |
| Molecular Formula | C20H20F2N2OS |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2F)cs1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H20F2N2OS/c21-14-1-2-15(16(22)6-14)17-10-26-19(23-17)24-18(25)20-7-11-3-12(8-20)5-13(4-11)9-20/h1-2,6,10-13H,3-5,7-9H2,(H,23,24,25) |
| InChIKey | HIUOSBCSEKQGOC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |