C23H16F2N2OS — CID 2165576
N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide (PubChem CID 2165576) has the molecular formula C23H16F2N2OS and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide.
| Compound Name | N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 2165576 |
| Molecular Formula | C23H16F2N2OS |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2F)cs1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H16F2N2OS/c24-17-11-12-18(19(25)13-17)20-14-29-23(26-20)27-22(28)21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,21H,(H,26,27,28) |
| InChIKey | QUZPSMUGWWIENU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |