C11H7ClF2N2OS — CID 4202014
2-chloro-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 4202014) has the molecular formula C11H7ClF2N2OS and a molecular weight of 288.71 g/mol. Its IUPAC name is 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 4202014 |
| Molecular Formula | C11H7ClF2N2OS |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CCl)Nc1nc(-c2ccc(F)cc2F)cs1 |
| InChI | InChI=1S/C11H7ClF2N2OS/c12-4-10(17)16-11-15-9(5-18-11)7-2-1-6(13)3-8(7)14/h1-3,5H,4H2,(H,15,16,17) |
| InChIKey | AHVLYPJROVJASL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|