C26H14F4N4O2S2 — CID 4116905
1-N,4-N-bis[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]benzene-1,4-dicarboxamide (PubChem CID 4116905) has the molecular formula C26H14F4N4O2S2 and a molecular weight of 554.55 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4116905 |
| Molecular Formula | C26H14F4N4O2S2 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | 1-N,4-N-bis[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2F)cs1)c1ccc(C(=O)Nc2nc(-c3ccc(F)cc3F)cs2)cc1 |
| InChI | InChI=1S/C26H14F4N4O2S2/c27-15-5-7-17(19(29)9-15)21-11-37-25(31-21)33-23(35)13-1-2-14(4-3-13)24(36)34-26-32-22(12-38-26)18-8-6-16(28)10-20(18)30/h1-12H,(H,31,33,35)(H,32,34,36) |
| InChIKey | AMFWWMJDNIVCDD-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |