C20H13FN2OS — CID 694785
4-fluoro-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 694785) has the molecular formula C20H13FN2OS and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-fluoro-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-fluoro-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 694785 |
| Molecular Formula | C20H13FN2OS |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-fluoro-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2cccc3ccccc23)cs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H13FN2OS/c21-15-10-8-14(9-11-15)19(24)23-20-22-18(12-25-20)17-7-3-5-13-4-1-2-6-16(13)17/h1-12H,(H,22,23,24) |
| InChIKey | PFGLNAIANHLHRW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |