C27H18N2O3S — CID 3228346
2-[2-[(4-naphthalen-1-yl-1,3-thiazol-2-yl)carbamoyl]phenyl]benzoic acid (PubChem CID 3228346) has the molecular formula C27H18N2O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-[2-[(4-naphthalen-1-yl-1,3-thiazol-2-yl)carbamoyl]phenyl]benzoic acid.
| Compound Name | 2-[2-[(4-naphthalen-1-yl-1,3-thiazol-2-yl)carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 3228346 |
| Molecular Formula | C27H18N2O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-[2-[(4-naphthalen-1-yl-1,3-thiazol-2-yl)carbamoyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccccc1C(=O)Nc1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C27H18N2O3S/c30-25(22-13-5-3-11-19(22)20-12-4-6-14-23(20)26(31)32)29-27-28-24(16-33-27)21-15-7-9-17-8-1-2-10-18(17)21/h1-16H,(H,31,32)(H,28,29,30) |
| InChIKey | ICIKIDDBXIYFGQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |