C23H20N2OS2 — CID 4038932
N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-4-phenylsulfanylbutanamide (PubChem CID 4038932) has the molecular formula C23H20N2OS2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-4-phenylsulfanylbutanamide.
| Compound Name | N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 4038932 |
| Molecular Formula | C23H20N2OS2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-4-phenylsulfanylbutanamide |
| SMILES | O=C(CCCSc1ccccc1)Nc1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C23H20N2OS2/c26-22(14-7-15-27-18-10-2-1-3-11-18)25-23-24-21(16-28-23)20-13-6-9-17-8-4-5-12-19(17)20/h1-6,8-13,16H,7,14-15H2,(H,24,25,26) |
| InChIKey | LGYMPWRJWUDYIT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|