C25H21FN2O2S2 — CID 41086951
4-(4-fluorophenyl)sulfanyl-N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 41086951) has the molecular formula C25H21FN2O2S2 and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfanyl-N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(4-fluorophenyl)sulfanyl-N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 41086951 |
| Molecular Formula | C25H21FN2O2S2 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 4-(4-fluorophenyl)sulfanyl-N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | O=C(CCCSc1ccc(F)cc1)Nc1nc(-c2ccc(Oc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C25H21FN2O2S2/c26-19-10-14-22(15-11-19)31-16-4-7-24(29)28-25-27-23(17-32-25)18-8-12-21(13-9-18)30-20-5-2-1-3-6-20/h1-3,5-6,8-15,17H,4,7,16H2,(H,27,28,29) |
| InChIKey | RRZBMDSPMKXKAL-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|