C21H17FN2O2S2 — CID 8702534
N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide (PubChem CID 8702534) has the molecular formula C21H17FN2O2S2 and a molecular weight of 412.51 g/mol. Its IUPAC name is N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide.
| Compound Name | N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 8702534 |
| Molecular Formula | C21H17FN2O2S2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-4-(4-fluorophenyl)sulfanylbutanamide |
| SMILES | O=C(CCCSc1ccc(F)cc1)Nc1nc(-c2cc3ccccc3o2)cs1 |
| InChI | InChI=1S/C21H17FN2O2S2/c22-15-7-9-16(10-8-15)27-11-3-6-20(25)24-21-23-17(13-28-21)19-12-14-4-1-2-5-18(14)26-19/h1-2,4-5,7-10,12-13H,3,6,11H2,(H,23,24,25) |
| InChIKey | CJWNSSOMRPUCOA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|