C22H20N2O5S2 — CID 25319309
N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-4-(4-methoxyphenyl)sulfonylbutanamide (PubChem CID 25319309) has the molecular formula C22H20N2O5S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-4-(4-methoxyphenyl)sulfonylbutanamide.
| Compound Name | N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-4-(4-methoxyphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 25319309 |
| Molecular Formula | C22H20N2O5S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-4-(4-methoxyphenyl)sulfonylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)CCCC(=O)Nc2nc(-c3cc4ccccc4o3)cs2)cc1 |
| InChI | InChI=1S/C22H20N2O5S2/c1-28-16-8-10-17(11-9-16)31(26,27)12-4-7-21(25)24-22-23-18(14-30-22)20-13-15-5-2-3-6-19(15)29-20/h2-3,5-6,8-11,13-14H,4,7,12H2,1H3,(H,23,24,25) |
| InChIKey | AQTQIQKIVPFGER-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |