C22H24N2O4S2 — CID 41273043
4-(benzenesulfonyl)-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 41273043) has the molecular formula C22H24N2O4S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(benzenesulfonyl)-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 41273043 |
| Molecular Formula | C22H24N2O4S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | CCCOc1ccc(-c2csc(NC(=O)CCCS(=O)(=O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H24N2O4S2/c1-2-14-28-18-12-10-17(11-13-18)20-16-29-22(23-20)24-21(25)9-6-15-30(26,27)19-7-4-3-5-8-19/h3-5,7-8,10-13,16H,2,6,9,14-15H2,1H3,(H,23,24,25) |
| InChIKey | WNGCCHBQSWQDIS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |