C23H20N2O3S2 — CID 41273052
4-(benzenesulfonyl)-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)butanamide (PubChem CID 41273052) has the molecular formula C23H20N2O3S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(benzenesulfonyl)-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 41273052 |
| Molecular Formula | C23H20N2O3S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 4-(benzenesulfonyl)-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)butanamide |
| SMILES | O=C(CCCS(=O)(=O)c1ccccc1)Nc1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C23H20N2O3S2/c26-22(14-7-15-30(27,28)18-10-2-1-3-11-18)25-23-24-21(16-29-23)20-13-6-9-17-8-4-5-12-19(17)20/h1-6,8-13,16H,7,14-15H2,(H,24,25,26) |
| InChIKey | DQZJFHUECHICMH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |