C19H19N3O4S2 — CID 41087352
4-(4-methoxyphenyl)sulfonyl-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)butanamide (PubChem CID 41087352) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 41087352 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)butanamide |
| SMILES | COc1ccc(S(=O)(=O)CCCC(=O)Nc2nc(-c3ccncc3)cs2)cc1 |
| InChI | InChI=1S/C19H19N3O4S2/c1-26-15-4-6-16(7-5-15)28(24,25)12-2-3-18(23)22-19-21-17(13-27-19)14-8-10-20-11-9-14/h4-11,13H,2-3,12H2,1H3,(H,21,22,23) |
| InChIKey | PXIOZVUTYOCJGP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |