C21H19FN2O5S2 — CID 41274445
methyl 4-[2-[4-(4-fluorophenyl)sulfonylbutanoylamino]-1,3-thiazol-4-yl]benzoate (PubChem CID 41274445) has the molecular formula C21H19FN2O5S2 and a molecular weight of 462.52 g/mol. Its IUPAC name is methyl 4-[2-[4-(4-fluorophenyl)sulfonylbutanoylamino]-1,3-thiazol-4-yl]benzoate.
| Compound Name | methyl 4-[2-[4-(4-fluorophenyl)sulfonylbutanoylamino]-1,3-thiazol-4-yl]benzoate |
|---|---|
| PubChem CID | 41274445 |
| Molecular Formula | C21H19FN2O5S2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | methyl 4-[2-[4-(4-fluorophenyl)sulfonylbutanoylamino]-1,3-thiazol-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2csc(NC(=O)CCCS(=O)(=O)c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C21H19FN2O5S2/c1-29-20(26)15-6-4-14(5-7-15)18-13-30-21(23-18)24-19(25)3-2-12-31(27,28)17-10-8-16(22)9-11-17/h4-11,13H,2-3,12H2,1H3,(H,23,24,25) |
| InChIKey | HSZATTNLHKENBQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |